C14H27N3O2 — CID 64979235
2-(2,5-diethylpiperazin-1-yl)-1-morpholin-4-ylethanone (PubChem CID 64979235) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-(2,5-diethylpiperazin-1-yl)-1-morpholin-4-ylethanone.
| Compound Name | 2-(2,5-diethylpiperazin-1-yl)-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 64979235 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 2-(2,5-diethylpiperazin-1-yl)-1-morpholin-4-ylethanone |
| SMILES | CCC1CN(CC(=O)N2CCOCC2)C(CC)CN1 |
| InChI | InChI=1S/C14H27N3O2/c1-3-12-10-17(13(4-2)9-15-12)11-14(18)16-5-7-19-8-6-16/h12-13,15H,3-11H2,1-2H3 |
| InChIKey | LMAAWWQDYUGDMA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |