C12H23ClN2 — CID 106439468
1-(3-chloro-2-methylprop-2-enyl)-2,5-diethylpiperazine (PubChem CID 106439468) has the molecular formula C12H23ClN2 and a molecular weight of 230.78 g/mol. Its IUPAC name is 1-(3-chloro-2-methylprop-2-enyl)-2,5-diethylpiperazine.
| Compound Name | 1-(3-chloro-2-methylprop-2-enyl)-2,5-diethylpiperazine |
|---|---|
| PubChem CID | 106439468 |
| Molecular Formula | C12H23ClN2 |
| Molecular Weight | 230.78 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1-(3-chloro-2-methylprop-2-enyl)-2,5-diethylpiperazine |
| SMILES | CCC1CN(CC(C)=CCl)C(CC)CN1 |
| InChI | InChI=1S/C12H23ClN2/c1-4-11-9-15(8-10(3)6-13)12(5-2)7-14-11/h6,11-12,14H,4-5,7-9H2,1-3H3 |
| InChIKey | JQJUSQDIVQKHFL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.78 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |