About 2-(2,5-diethylpiperazin-1-yl)-N,N-dipropylacetamide
2-(2,5-diethylpiperazin-1-yl)-N,N-dipropylacetamide (PubChem CID 64978870) has the molecular formula C16H33N3O
and a molecular weight of 283.46 g/mol. Its IUPAC name is 2-(2,5-diethylpiperazin-1-yl)-N,N-dipropylacetamide.
Molecular Properties
| Compound Name | 2-(2,5-diethylpiperazin-1-yl)-N,N-dipropylacetamide |
| PubChem CID | 64978870 |
| Molecular Formula | C16H33N3O |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | 2-(2,5-diethylpiperazin-1-yl)-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)CN1CC(CC)NCC1CC |
| InChI | InChI=1S/C16H33N3O/c1-5-9-18(10-6-2)16(20)13-19-12-14(7-3)17-11-15(19)8-4/h14-15,17H,5-13H2,1-4H3 |
| InChIKey | NZNFOOXPKPYWQI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,5-diethylpiperazin-1-yl)-N,N-dipropylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-diethylpiperazin-1-yl)-N,N-dipropylacetamide?
The IUPAC name of 2-(2,5-diethylpiperazin-1-yl)-N,N-dipropylacetamide (CID 64978870) is 2-(2,5-diethylpiperazin-1-yl)-N,N-dipropylacetamide.
What is the SMILES notation for 2-(2,5-diethylpiperazin-1-yl)-N,N-dipropylacetamide?
The canonical SMILES for 2-(2,5-diethylpiperazin-1-yl)-N,N-dipropylacetamide is CCCN(CCC)C(=O)CN1CC(CC)NCC1CC.
What is the InChIKey of 2-(2,5-diethylpiperazin-1-yl)-N,N-dipropylacetamide?
The InChIKey is NZNFOOXPKPYWQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33N3O/c1-5-9-18(10-6-2)16(20)13-19-12-14(7-3)17-11-15(19)8-4/h14-15,17H,5-13H2,1-4H3.
What are the key properties of 2-(2,5-diethylpiperazin-1-yl)-N,N-dipropylacetamide?
2-(2,5-diethylpiperazin-1-yl)-N,N-dipropylacetamide has a molecular weight of 283.46 g/mol, XLogP of 2.10, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-diethylpiperazin-1-yl)-N,N-dipropylacetamide is sourced from PubChem (CID 64978870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).