C11H21BrN2 — CID 64978694
1-(2-bromoprop-2-enyl)-2,5-diethylpiperazine (PubChem CID 64978694) has the molecular formula C11H21BrN2 and a molecular weight of 261.21 g/mol. Its IUPAC name is 1-(2-bromoprop-2-enyl)-2,5-diethylpiperazine.
| Compound Name | 1-(2-bromoprop-2-enyl)-2,5-diethylpiperazine |
|---|---|
| PubChem CID | 64978694 |
| Molecular Formula | C11H21BrN2 |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 1-(2-bromoprop-2-enyl)-2,5-diethylpiperazine |
| SMILES | C=C(Br)CN1CC(CC)NCC1CC |
| InChI | InChI=1S/C11H21BrN2/c1-4-10-8-14(7-9(3)12)11(5-2)6-13-10/h10-11,13H,3-8H2,1-2H3 |
| InChIKey | MRKAEOUBOJONNT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |