C16H13Cl2N3 — CID 64983276
6,8-dichloro-N-methyl-2-(3-methylphenyl)quinazolin-4-amine (PubChem CID 64983276) has the molecular formula C16H13Cl2N3 and a molecular weight of 318.21 g/mol. Its IUPAC name is 6,8-dichloro-N-methyl-2-(3-methylphenyl)quinazolin-4-amine.
| Compound Name | 6,8-dichloro-N-methyl-2-(3-methylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 64983276 |
| Molecular Formula | C16H13Cl2N3 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 6,8-dichloro-N-methyl-2-(3-methylphenyl)quinazolin-4-amine |
| SMILES | CNc1nc(-c2cccc(C)c2)nc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C16H13Cl2N3/c1-9-4-3-5-10(6-9)15-20-14-12(16(19-2)21-15)7-11(17)8-13(14)18/h3-8H,1-2H3,(H,19,20,21) |
| InChIKey | BEYUPEFTLBNYOM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |