C16H18INO2S — CID 64989532
N-[(4,5-dimethoxy-2-methylsulfanylphenyl)methyl]-2-iodoaniline (PubChem CID 64989532) has the molecular formula C16H18INO2S and a molecular weight of 415.30 g/mol. Its IUPAC name is N-[(4,5-dimethoxy-2-methylsulfanylphenyl)methyl]-2-iodoaniline.
| Compound Name | N-[(4,5-dimethoxy-2-methylsulfanylphenyl)methyl]-2-iodoaniline |
|---|---|
| PubChem CID | 64989532 |
| Molecular Formula | C16H18INO2S |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | N-[(4,5-dimethoxy-2-methylsulfanylphenyl)methyl]-2-iodoaniline |
| SMILES | COc1cc(CNc2ccccc2I)c(SC)cc1OC |
| InChI | InChI=1S/C16H18INO2S/c1-19-14-8-11(16(21-3)9-15(14)20-2)10-18-13-7-5-4-6-12(13)17/h4-9,18H,10H2,1-3H3 |
| InChIKey | XREHPTOPOQPJLS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|