C12H12N4S — CID 64992997
N-[1-(1,3-thiazol-2-yl)ethyl]-1H-indazol-4-amine (PubChem CID 64992997) has the molecular formula C12H12N4S and a molecular weight of 244.32 g/mol. Its IUPAC name is N-[1-(1,3-thiazol-2-yl)ethyl]-1H-indazol-4-amine.
| Compound Name | N-[1-(1,3-thiazol-2-yl)ethyl]-1H-indazol-4-amine |
|---|---|
| PubChem CID | 64992997 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | N-[1-(1,3-thiazol-2-yl)ethyl]-1H-indazol-4-amine |
| SMILES | CC(Nc1cccc2[nH]ncc12)c1nccs1 |
| InChI | InChI=1S/C12H12N4S/c1-8(12-13-5-6-17-12)15-10-3-2-4-11-9(10)7-14-16-11/h2-8,15H,1H3,(H,14,16) |
| InChIKey | BSHACLJKXYFDMY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |