C15H21ClO4S — CID 65003088
[1-[(4-methoxyphenyl)methoxymethyl]cyclopentyl]methanesulfonyl chloride (PubChem CID 65003088) has the molecular formula C15H21ClO4S and a molecular weight of 332.85 g/mol. Its IUPAC name is [1-[(4-methoxyphenyl)methoxymethyl]cyclopentyl]methanesulfonyl chloride.
| Compound Name | [1-[(4-methoxyphenyl)methoxymethyl]cyclopentyl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 65003088 |
| Molecular Formula | C15H21ClO4S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [1-[(4-methoxyphenyl)methoxymethyl]cyclopentyl]methanesulfonyl chloride |
| SMILES | COc1ccc(COCC2(CS(=O)(=O)Cl)CCCC2)cc1 |
| InChI | InChI=1S/C15H21ClO4S/c1-19-14-6-4-13(5-7-14)10-20-11-15(8-2-3-9-15)12-21(16,17)18/h4-7H,2-3,8-12H2,1H3 |
| InChIKey | CJHKEGXROINIDT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |