C15H20ClFO3S — CID 65006748
[1-[(2-fluorophenyl)methoxymethyl]cyclohexyl]methanesulfonyl chloride (PubChem CID 65006748) has the molecular formula C15H20ClFO3S and a molecular weight of 334.84 g/mol. Its IUPAC name is [1-[(2-fluorophenyl)methoxymethyl]cyclohexyl]methanesulfonyl chloride.
| Compound Name | [1-[(2-fluorophenyl)methoxymethyl]cyclohexyl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 65006748 |
| Molecular Formula | C15H20ClFO3S |
| Molecular Weight | 334.84 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | [1-[(2-fluorophenyl)methoxymethyl]cyclohexyl]methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)CC1(COCc2ccccc2F)CCCCC1 |
| InChI | InChI=1S/C15H20ClFO3S/c16-21(18,19)12-15(8-4-1-5-9-15)11-20-10-13-6-2-3-7-14(13)17/h2-3,6-7H,1,4-5,8-12H2 |
| InChIKey | DEUDULPXVKABIS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.84 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |