C12H20ClF3O3S — CID 82793786
[1-(4,4,4-trifluorobutoxymethyl)cyclohexyl]methanesulfonyl chloride (PubChem CID 82793786) has the molecular formula C12H20ClF3O3S and a molecular weight of 336.80 g/mol. Its IUPAC name is [1-(4,4,4-trifluorobutoxymethyl)cyclohexyl]methanesulfonyl chloride.
| Compound Name | [1-(4,4,4-trifluorobutoxymethyl)cyclohexyl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 82793786 |
| Molecular Formula | C12H20ClF3O3S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [1-(4,4,4-trifluorobutoxymethyl)cyclohexyl]methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)CC1(COCCCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C12H20ClF3O3S/c13-20(17,18)10-11(5-2-1-3-6-11)9-19-8-4-7-12(14,15)16/h1-10H2 |
| InChIKey | LLGXRCANWRSWAS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|