C11H18ClF3O3S — CID 82959382
[1-(3,3,3-trifluoropropoxymethyl)cyclohexyl]methanesulfonyl chloride (PubChem CID 82959382) has the molecular formula C11H18ClF3O3S and a molecular weight of 322.78 g/mol. Its IUPAC name is [1-(3,3,3-trifluoropropoxymethyl)cyclohexyl]methanesulfonyl chloride.
| Compound Name | [1-(3,3,3-trifluoropropoxymethyl)cyclohexyl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 82959382 |
| Molecular Formula | C11H18ClF3O3S |
| Molecular Weight | 322.78 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | [1-(3,3,3-trifluoropropoxymethyl)cyclohexyl]methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)CC1(COCCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C11H18ClF3O3S/c12-19(16,17)9-10(4-2-1-3-5-10)8-18-7-6-11(13,14)15/h1-9H2 |
| InChIKey | KFLVMOVITAULTP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.78 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|