C15H25NO3S — CID 65003591
2-[(2,3-dimethylphenoxy)methyl]-2-ethylbutane-1-sulfonamide (PubChem CID 65003591) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-[(2,3-dimethylphenoxy)methyl]-2-ethylbutane-1-sulfonamide.
| Compound Name | 2-[(2,3-dimethylphenoxy)methyl]-2-ethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 65003591 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-[(2,3-dimethylphenoxy)methyl]-2-ethylbutane-1-sulfonamide |
| SMILES | CCC(CC)(COc1cccc(C)c1C)CS(N)(=O)=O |
| InChI | InChI=1S/C15H25NO3S/c1-5-15(6-2,11-20(16,17)18)10-19-14-9-7-8-12(3)13(14)4/h7-9H,5-6,10-11H2,1-4H3,(H2,16,17,18) |
| InChIKey | JOEBUCAWCKVIHB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |