C16H19NO3S — CID 69237538
2-(2,3-dimethylphenoxy)-3-ethylbenzenesulfonamide (PubChem CID 69237538) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-3-ethylbenzenesulfonamide.
| Compound Name | 2-(2,3-dimethylphenoxy)-3-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 69237538 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-3-ethylbenzenesulfonamide |
| SMILES | CCc1cccc(S(N)(=O)=O)c1Oc1cccc(C)c1C |
| InChI | InChI=1S/C16H19NO3S/c1-4-13-8-6-10-15(21(17,18)19)16(13)20-14-9-5-7-11(2)12(14)3/h5-10H,4H2,1-3H3,(H2,17,18,19) |
| InChIKey | NOTDESFSKDVONN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |