C19H16N2O4S2 — CID 6500447
phenacyl 2-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylacetate (PubChem CID 6500447) has the molecular formula C19H16N2O4S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is phenacyl 2-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylacetate.
| Compound Name | phenacyl 2-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 6500447 |
| Molecular Formula | C19H16N2O4S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | phenacyl 2-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylacetate |
| SMILES | O=C(CSCC(=O)OCC(=O)c1ccccc1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H16N2O4S2/c22-15(13-6-2-1-3-7-13)10-25-18(24)12-26-11-17(23)21-19-20-14-8-4-5-9-16(14)27-19/h1-9H,10-12H2,(H,20,21,23) |
| InChIKey | OJONQEZQKHHUJU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |