C14H29NO4S — CID 65005013
2-(oxolan-3-ylmethoxymethyl)-2-propylpentane-1-sulfonamide (PubChem CID 65005013) has the molecular formula C14H29NO4S and a molecular weight of 307.46 g/mol. Its IUPAC name is 2-(oxolan-3-ylmethoxymethyl)-2-propylpentane-1-sulfonamide.
| Compound Name | 2-(oxolan-3-ylmethoxymethyl)-2-propylpentane-1-sulfonamide |
|---|---|
| PubChem CID | 65005013 |
| Molecular Formula | C14H29NO4S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 2-(oxolan-3-ylmethoxymethyl)-2-propylpentane-1-sulfonamide |
| SMILES | CCCC(CCC)(COCC1CCOC1)CS(N)(=O)=O |
| InChI | InChI=1S/C14H29NO4S/c1-3-6-14(7-4-2,12-20(15,16)17)11-19-10-13-5-8-18-9-13/h13H,3-12H2,1-2H3,(H2,15,16,17) |
| InChIKey | XKKQVMLFRXKTPJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |