C15H30BrNO — CID 65005180
4-[2-(bromomethyl)-2-propylpentyl]-2-methyl-1,4-oxazepane (PubChem CID 65005180) has the molecular formula C15H30BrNO and a molecular weight of 320.32 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-2-propylpentyl]-2-methyl-1,4-oxazepane.
| Compound Name | 4-[2-(bromomethyl)-2-propylpentyl]-2-methyl-1,4-oxazepane |
|---|---|
| PubChem CID | 65005180 |
| Molecular Formula | C15H30BrNO |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 4-[2-(bromomethyl)-2-propylpentyl]-2-methyl-1,4-oxazepane |
| SMILES | CCCC(CBr)(CCC)CN1CCCOC(C)C1 |
| InChI | InChI=1S/C15H30BrNO/c1-4-7-15(12-16,8-5-2)13-17-9-6-10-18-14(3)11-17/h14H,4-13H2,1-3H3 |
| InChIKey | CPWYXNJSGYZLRS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|