C17H32BrN — CID 65005287
2-(bromomethyl)-N,N-bis(cyclopropylmethyl)-2-propylpentan-1-amine (PubChem CID 65005287) has the molecular formula C17H32BrN and a molecular weight of 330.35 g/mol. Its IUPAC name is 2-(bromomethyl)-N,N-bis(cyclopropylmethyl)-2-propylpentan-1-amine.
| Compound Name | 2-(bromomethyl)-N,N-bis(cyclopropylmethyl)-2-propylpentan-1-amine |
|---|---|
| PubChem CID | 65005287 |
| Molecular Formula | C17H32BrN |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-(bromomethyl)-N,N-bis(cyclopropylmethyl)-2-propylpentan-1-amine |
| SMILES | CCCC(CBr)(CCC)CN(CC1CC1)CC1CC1 |
| InChI | InChI=1S/C17H32BrN/c1-3-9-17(13-18,10-4-2)14-19(11-15-5-6-15)12-16-7-8-16/h15-16H,3-14H2,1-2H3 |
| InChIKey | MLTIJJUJLQAKIC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|