C17H36BrNO2 — CID 82938035
2-(bromomethyl)-N,N-bis(2-ethoxyethyl)-2-propylpentan-1-amine (PubChem CID 82938035) has the molecular formula C17H36BrNO2 and a molecular weight of 366.38 g/mol. Its IUPAC name is 2-(bromomethyl)-N,N-bis(2-ethoxyethyl)-2-propylpentan-1-amine.
| Compound Name | 2-(bromomethyl)-N,N-bis(2-ethoxyethyl)-2-propylpentan-1-amine |
|---|---|
| PubChem CID | 82938035 |
| Molecular Formula | C17H36BrNO2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-(bromomethyl)-N,N-bis(2-ethoxyethyl)-2-propylpentan-1-amine |
| SMILES | CCCC(CBr)(CCC)CN(CCOCC)CCOCC |
| InChI | InChI=1S/C17H36BrNO2/c1-5-9-17(15-18,10-6-2)16-19(11-13-20-7-3)12-14-21-8-4/h5-16H2,1-4H3 |
| InChIKey | BHJGDOAJHIZYHB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|