C14H13Br2NO2 — CID 65007404
5-bromo-1-[[1-(bromomethyl)cyclobutyl]methyl]indole-2,3-dione (PubChem CID 65007404) has the molecular formula C14H13Br2NO2 and a molecular weight of 387.07 g/mol. Its IUPAC name is 5-bromo-1-[[1-(bromomethyl)cyclobutyl]methyl]indole-2,3-dione.
| Compound Name | 5-bromo-1-[[1-(bromomethyl)cyclobutyl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 65007404 |
| Molecular Formula | C14H13Br2NO2 |
| Molecular Weight | 387.07 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | 5-bromo-1-[[1-(bromomethyl)cyclobutyl]methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CC2(CBr)CCC2)c2ccc(Br)cc21 |
| InChI | InChI=1S/C14H13Br2NO2/c15-7-14(4-1-5-14)8-17-11-3-2-9(16)6-10(11)12(18)13(17)19/h2-3,6H,1,4-5,7-8H2 |
| InChIKey | AOJLKTMSVOZBQH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.07 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|