C17H20BrNO2 — CID 65001743
1-[[1-(bromomethyl)cyclopentyl]methyl]-6,7-dimethylindole-2,3-dione (PubChem CID 65001743) has the molecular formula C17H20BrNO2 and a molecular weight of 350.26 g/mol. Its IUPAC name is 1-[[1-(bromomethyl)cyclopentyl]methyl]-6,7-dimethylindole-2,3-dione.
| Compound Name | 1-[[1-(bromomethyl)cyclopentyl]methyl]-6,7-dimethylindole-2,3-dione |
|---|---|
| PubChem CID | 65001743 |
| Molecular Formula | C17H20BrNO2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-[[1-(bromomethyl)cyclopentyl]methyl]-6,7-dimethylindole-2,3-dione |
| SMILES | Cc1ccc2c(c1C)N(CC1(CBr)CCCC1)C(=O)C2=O |
| InChI | InChI=1S/C17H20BrNO2/c1-11-5-6-13-14(12(11)2)19(16(21)15(13)20)10-17(9-18)7-3-4-8-17/h5-6H,3-4,7-10H2,1-2H3 |
| InChIKey | XRUIUQVQRYFZFH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|