C10H16BrClN2 — CID 65012337
1-[2-(bromomethyl)-3-methylbutyl]-4-chloro-5-methylpyrazole (PubChem CID 65012337) has the molecular formula C10H16BrClN2 and a molecular weight of 279.61 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3-methylbutyl]-4-chloro-5-methylpyrazole.
| Compound Name | 1-[2-(bromomethyl)-3-methylbutyl]-4-chloro-5-methylpyrazole |
|---|---|
| PubChem CID | 65012337 |
| Molecular Formula | C10H16BrClN2 |
| Molecular Weight | 279.61 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 1-[2-(bromomethyl)-3-methylbutyl]-4-chloro-5-methylpyrazole |
| SMILES | Cc1c(Cl)cnn1CC(CBr)C(C)C |
| InChI | InChI=1S/C10H16BrClN2/c1-7(2)9(4-11)6-14-8(3)10(12)5-13-14/h5,7,9H,4,6H2,1-3H3 |
| InChIKey | RSQFVCLVHTYGKT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|