C15H23ClN2O2 — CID 65021919
2-(3-chloro-4-methoxyphenyl)-2-(3-ethylmorpholin-4-yl)ethanamine (PubChem CID 65021919) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyphenyl)-2-(3-ethylmorpholin-4-yl)ethanamine.
| Compound Name | 2-(3-chloro-4-methoxyphenyl)-2-(3-ethylmorpholin-4-yl)ethanamine |
|---|---|
| PubChem CID | 65021919 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-(3-chloro-4-methoxyphenyl)-2-(3-ethylmorpholin-4-yl)ethanamine |
| SMILES | CCC1COCCN1C(CN)c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C15H23ClN2O2/c1-3-12-10-20-7-6-18(12)14(9-17)11-4-5-15(19-2)13(16)8-11/h4-5,8,12,14H,3,6-7,9-10,17H2,1-2H3 |
| InChIKey | YKCONTLJRNWARW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |