C18H30ClN3O — CID 83979881
2-(3-chloro-4-propan-2-yloxyphenyl)-2-(2-ethyl-4-methylpiperazin-1-yl)ethanamine (PubChem CID 83979881) has the molecular formula C18H30ClN3O and a molecular weight of 339.91 g/mol. Its IUPAC name is 2-(3-chloro-4-propan-2-yloxyphenyl)-2-(2-ethyl-4-methylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(3-chloro-4-propan-2-yloxyphenyl)-2-(2-ethyl-4-methylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 83979881 |
| Molecular Formula | C18H30ClN3O |
| Molecular Weight | 339.91 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 2-(3-chloro-4-propan-2-yloxyphenyl)-2-(2-ethyl-4-methylpiperazin-1-yl)ethanamine |
| SMILES | CCC1CN(C)CCN1C(CN)c1ccc(OC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C18H30ClN3O/c1-5-15-12-21(4)8-9-22(15)17(11-20)14-6-7-18(16(19)10-14)23-13(2)3/h6-7,10,13,15,17H,5,8-9,11-12,20H2,1-4H3 |
| InChIKey | QYIKMKGAHIIUGQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.91 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |