C17H28ClN3O — CID 83979851
2-(3-chloro-4-ethoxyphenyl)-2-(4-ethyl-2-methylpiperazin-1-yl)ethanamine (PubChem CID 83979851) has the molecular formula C17H28ClN3O and a molecular weight of 325.88 g/mol. Its IUPAC name is 2-(3-chloro-4-ethoxyphenyl)-2-(4-ethyl-2-methylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(3-chloro-4-ethoxyphenyl)-2-(4-ethyl-2-methylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 83979851 |
| Molecular Formula | C17H28ClN3O |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-(3-chloro-4-ethoxyphenyl)-2-(4-ethyl-2-methylpiperazin-1-yl)ethanamine |
| SMILES | CCOc1ccc(C(CN)N2CCN(CC)CC2C)cc1Cl |
| InChI | InChI=1S/C17H28ClN3O/c1-4-20-8-9-21(13(3)12-20)16(11-19)14-6-7-17(22-5-2)15(18)10-14/h6-7,10,13,16H,4-5,8-9,11-12,19H2,1-3H3 |
| InChIKey | YNOULCGQNVRJMA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |