C15H22Cl2N2O — CID 112539285
2-(2,6-dichlorophenyl)-2-(4-ethyl-2-methylpiperazin-1-yl)ethanol (PubChem CID 112539285) has the molecular formula C15H22Cl2N2O and a molecular weight of 317.26 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-2-(4-ethyl-2-methylpiperazin-1-yl)ethanol.
| Compound Name | 2-(2,6-dichlorophenyl)-2-(4-ethyl-2-methylpiperazin-1-yl)ethanol |
|---|---|
| PubChem CID | 112539285 |
| Molecular Formula | C15H22Cl2N2O |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-2-(4-ethyl-2-methylpiperazin-1-yl)ethanol |
| SMILES | CCN1CCN(C(CO)c2c(Cl)cccc2Cl)C(C)C1 |
| InChI | InChI=1S/C15H22Cl2N2O/c1-3-18-7-8-19(11(2)9-18)14(10-20)15-12(16)5-4-6-13(15)17/h4-6,11,14,20H,3,7-10H2,1-2H3 |
| InChIKey | JMAKZCBLPUMZBT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |