C16H25Cl2N3 — CID 83977835
2-(2,6-dichlorophenyl)-2-(2,4-diethylpiperazin-1-yl)ethanamine (PubChem CID 83977835) has the molecular formula C16H25Cl2N3 and a molecular weight of 330.30 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-2-(2,4-diethylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(2,6-dichlorophenyl)-2-(2,4-diethylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 83977835 |
| Molecular Formula | C16H25Cl2N3 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-2-(2,4-diethylpiperazin-1-yl)ethanamine |
| SMILES | CCC1CN(CC)CCN1C(CN)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H25Cl2N3/c1-3-12-11-20(4-2)8-9-21(12)15(10-19)16-13(17)6-5-7-14(16)18/h5-7,12,15H,3-4,8-11,19H2,1-2H3 |
| InChIKey | PYSJKIVNRUBSPB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |