C10H19ClF3NO — CID 65024834
1-chloro-2-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]butan-2-amine (PubChem CID 65024834) has the molecular formula C10H19ClF3NO and a molecular weight of 261.71 g/mol. Its IUPAC name is 1-chloro-2-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]butan-2-amine.
| Compound Name | 1-chloro-2-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]butan-2-amine |
|---|---|
| PubChem CID | 65024834 |
| Molecular Formula | C10H19ClF3NO |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 1-chloro-2-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]butan-2-amine |
| SMILES | CCC(C)(CCl)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C10H19ClF3NO/c1-3-9(2,7-11)15-5-4-6-16-8-10(12,13)14/h15H,3-8H2,1-2H3 |
| InChIKey | NMICZTSJLWORTF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|