C12H18N2O3S2 — CID 6502872
4-(cyclohexylsulfamoyl)-5-methylthiophene-2-carboxamide (PubChem CID 6502872) has the molecular formula C12H18N2O3S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-(cyclohexylsulfamoyl)-5-methylthiophene-2-carboxamide.
| Compound Name | 4-(cyclohexylsulfamoyl)-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 6502872 |
| Molecular Formula | C12H18N2O3S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 4-(cyclohexylsulfamoyl)-5-methylthiophene-2-carboxamide |
| SMILES | Cc1sc(C(N)=O)cc1S(=O)(=O)NC1CCCCC1 |
| InChI | InChI=1S/C12H18N2O3S2/c1-8-11(7-10(18-8)12(13)15)19(16,17)14-9-5-3-2-4-6-9/h7,9,14H,2-6H2,1H3,(H2,13,15) |
| InChIKey | JEIIUXJLQRATLI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |