C16H23N3O2S2 — CID 53138840
N-cycloheptyl-2-methyl-5-(5-methyl-1H-pyrazol-3-yl)thiophene-3-sulfonamide (PubChem CID 53138840) has the molecular formula C16H23N3O2S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is N-cycloheptyl-2-methyl-5-(5-methyl-1H-pyrazol-3-yl)thiophene-3-sulfonamide.
| Compound Name | N-cycloheptyl-2-methyl-5-(5-methyl-1H-pyrazol-3-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 53138840 |
| Molecular Formula | C16H23N3O2S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-cycloheptyl-2-methyl-5-(5-methyl-1H-pyrazol-3-yl)thiophene-3-sulfonamide |
| SMILES | Cc1cc(-c2cc(S(=O)(=O)NC3CCCCCC3)c(C)s2)n[nH]1 |
| InChI | InChI=1S/C16H23N3O2S2/c1-11-9-14(18-17-11)15-10-16(12(2)22-15)23(20,21)19-13-7-5-3-4-6-8-13/h9-10,13,19H,3-8H2,1-2H3,(H,17,18) |
| InChIKey | AQPNFFRNBNBHDF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |