C12H15BrClNO2S — CID 65030927
2-bromo-N-[1-(chloromethyl)cyclopentyl]benzenesulfonamide (PubChem CID 65030927) has the molecular formula C12H15BrClNO2S and a molecular weight of 352.68 g/mol. Its IUPAC name is 2-bromo-N-[1-(chloromethyl)cyclopentyl]benzenesulfonamide.
| Compound Name | 2-bromo-N-[1-(chloromethyl)cyclopentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 65030927 |
| Molecular Formula | C12H15BrClNO2S |
| Molecular Weight | 352.68 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 2-bromo-N-[1-(chloromethyl)cyclopentyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1(CCl)CCCC1)c1ccccc1Br |
| InChI | InChI=1S/C12H15BrClNO2S/c13-10-5-1-2-6-11(10)18(16,17)15-12(9-14)7-3-4-8-12/h1-2,5-6,15H,3-4,7-9H2 |
| InChIKey | CFBHRKGXKVULNL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.68 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|