C13H17Cl2NO2S — CID 65032608
2-chloro-N-[1-(chloromethyl)cyclohexyl]benzenesulfonamide (PubChem CID 65032608) has the molecular formula C13H17Cl2NO2S and a molecular weight of 322.26 g/mol. Its IUPAC name is 2-chloro-N-[1-(chloromethyl)cyclohexyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[1-(chloromethyl)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 65032608 |
| Molecular Formula | C13H17Cl2NO2S |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-chloro-N-[1-(chloromethyl)cyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1(CCl)CCCCC1)c1ccccc1Cl |
| InChI | InChI=1S/C13H17Cl2NO2S/c14-10-13(8-4-1-5-9-13)16-19(17,18)12-7-3-2-6-11(12)15/h2-3,6-7,16H,1,4-5,8-10H2 |
| InChIKey | ANMOSPOWLJPEFO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|