C10H20N2OS — CID 65035873
N-(3-ethoxypropyl)-5-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 65035873) has the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-5-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | N-(3-ethoxypropyl)-5-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 65035873 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-(3-ethoxypropyl)-5-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | CCOCCCNC1=NCC(C)CS1 |
| InChI | InChI=1S/C10H20N2OS/c1-3-13-6-4-5-11-10-12-7-9(2)8-14-10/h9H,3-8H2,1-2H3,(H,11,12) |
| InChIKey | NSDHBQLYIHAWNG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|