About 2-methoxy-4-N,4-N-dimethyl-3-N-(2-methylcyclopentyl)pyridine-3,4-diamine
2-methoxy-4-N,4-N-dimethyl-3-N-(2-methylcyclopentyl)pyridine-3,4-diamine (PubChem CID 65044066) has the molecular formula C14H23N3O
and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-methoxy-4-N,4-N-dimethyl-3-N-(2-methylcyclopentyl)pyridine-3,4-diamine.
Molecular Properties
| Compound Name | 2-methoxy-4-N,4-N-dimethyl-3-N-(2-methylcyclopentyl)pyridine-3,4-diamine |
| PubChem CID | 65044066 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 2-methoxy-4-N,4-N-dimethyl-3-N-(2-methylcyclopentyl)pyridine-3,4-diamine |
| SMILES | COc1nccc(N(C)C)c1NC1CCCC1C |
| InChI | InChI=1S/C14H23N3O/c1-10-6-5-7-11(10)16-13-12(17(2)3)8-9-15-14(13)18-4/h8-11,16H,5-7H2,1-4H3 |
| InChIKey | UINJOFLUIWMAAB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-4-N,4-N-dimethyl-3-N-(2-methylcyclopentyl)pyridine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4-N,4-N-dimethyl-3-N-(2-methylcyclopentyl)pyridine-3,4-diamine?
The IUPAC name of 2-methoxy-4-N,4-N-dimethyl-3-N-(2-methylcyclopentyl)pyridine-3,4-diamine (CID 65044066) is 2-methoxy-4-N,4-N-dimethyl-3-N-(2-methylcyclopentyl)pyridine-3,4-diamine.
What is the SMILES notation for 2-methoxy-4-N,4-N-dimethyl-3-N-(2-methylcyclopentyl)pyridine-3,4-diamine?
The canonical SMILES for 2-methoxy-4-N,4-N-dimethyl-3-N-(2-methylcyclopentyl)pyridine-3,4-diamine is COc1nccc(N(C)C)c1NC1CCCC1C.
What is the InChIKey of 2-methoxy-4-N,4-N-dimethyl-3-N-(2-methylcyclopentyl)pyridine-3,4-diamine?
The InChIKey is UINJOFLUIWMAAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O/c1-10-6-5-7-11(10)16-13-12(17(2)3)8-9-15-14(13)18-4/h8-11,16H,5-7H2,1-4H3.
What are the key properties of 2-methoxy-4-N,4-N-dimethyl-3-N-(2-methylcyclopentyl)pyridine-3,4-diamine?
2-methoxy-4-N,4-N-dimethyl-3-N-(2-methylcyclopentyl)pyridine-3,4-diamine has a molecular weight of 249.36 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4-N,4-N-dimethyl-3-N-(2-methylcyclopentyl)pyridine-3,4-diamine is sourced from PubChem (CID 65044066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).