C13H26N2O2S — CID 65045929
[1-(2-ethylpyrrolidin-1-yl)-2-methylsulfonylcyclopentyl]methanamine (PubChem CID 65045929) has the molecular formula C13H26N2O2S and a molecular weight of 274.43 g/mol. Its IUPAC name is [1-(2-ethylpyrrolidin-1-yl)-2-methylsulfonylcyclopentyl]methanamine.
| Compound Name | [1-(2-ethylpyrrolidin-1-yl)-2-methylsulfonylcyclopentyl]methanamine |
|---|---|
| PubChem CID | 65045929 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | [1-(2-ethylpyrrolidin-1-yl)-2-methylsulfonylcyclopentyl]methanamine |
| SMILES | CCC1CCCN1C1(CN)CCCC1S(C)(=O)=O |
| InChI | InChI=1S/C13H26N2O2S/c1-3-11-6-5-9-15(11)13(10-14)8-4-7-12(13)18(2,16)17/h11-12H,3-10,14H2,1-2H3 |
| InChIKey | CWICKDLFICJMOK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |