C16H30N2O2S — CID 65045721
[1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-methylsulfonylcyclopentyl]methanamine (PubChem CID 65045721) has the molecular formula C16H30N2O2S and a molecular weight of 314.50 g/mol. Its IUPAC name is [1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-methylsulfonylcyclopentyl]methanamine.
| Compound Name | [1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-methylsulfonylcyclopentyl]methanamine |
|---|---|
| PubChem CID | 65045721 |
| Molecular Formula | C16H30N2O2S |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | [1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-methylsulfonylcyclopentyl]methanamine |
| SMILES | CS(=O)(=O)C1CCCC1(CN)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C16H30N2O2S/c1-21(19,20)15-7-4-9-16(15,12-17)18-10-8-13-5-2-3-6-14(13)11-18/h13-15H,2-12,17H2,1H3 |
| InChIKey | MZMIIECALIOABY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |