C15H29N3O2S — CID 79917984
[1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-methylsulfonylcyclopentyl]methanamine (PubChem CID 79917984) has the molecular formula C15H29N3O2S and a molecular weight of 315.48 g/mol. Its IUPAC name is [1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-methylsulfonylcyclopentyl]methanamine.
| Compound Name | [1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-methylsulfonylcyclopentyl]methanamine |
|---|---|
| PubChem CID | 79917984 |
| Molecular Formula | C15H29N3O2S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | [1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-methylsulfonylcyclopentyl]methanamine |
| SMILES | CS(=O)(=O)C1CCCC1(CN)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C15H29N3O2S/c1-21(19,20)14-6-4-7-15(14,12-16)18-10-9-17-8-3-2-5-13(17)11-18/h13-14H,2-12,16H2,1H3 |
| InChIKey | VJMMQILSMQCLHA-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |