2-(9H-fluoren-9-ylamino)pentanoic acid

C18H19NO2 — CID 65054645

IUPAC2-(9H-fluoren-9-ylamino)pentanoic acid
SMILESCCCC(NC1c2ccccc2-c2ccccc21)C(=O)O
InChIInChI=1S/C18H19NO2/c1-2-7-16(18(20)21)19-17-14-10-5-3-8-12(14)13-9-4-6-11-15(13)17/h3-6,8-11,16-17,19H,2,7H2,1H3,(H,20,21)
InChIKeyMPOQNNPAVQIXLF-UHFFFAOYSA-N
MW281.36 g/mol
LogP3.60
Rot. Bonds5

About 2-(9H-fluoren-9-ylamino)pentanoic acid

2-(9H-fluoren-9-ylamino)pentanoic acid (PubChem CID 65054645) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylamino)pentanoic acid.

Molecular Properties

Compound Name2-(9H-fluoren-9-ylamino)pentanoic acid
PubChem CID65054645
Molecular FormulaC18H19NO2
Molecular Weight281.36 g/mol
Exact Mass281.14
IUPAC Name2-(9H-fluoren-9-ylamino)pentanoic acid
SMILESCCCC(NC1c2ccccc2-c2ccccc21)C(=O)O
InChIInChI=1S/C18H19NO2/c1-2-7-16(18(20)21)19-17-14-10-5-3-8-12(14)13-9-4-6-11-15(13)17/h3-6,8-11,16-17,19H,2,7H2,1H3,(H,20,21)
InChIKeyMPOQNNPAVQIXLF-UHFFFAOYSA-N
XLogP3.60
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.36
LogP ≤ 53.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(9H-fluoren-9-ylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[[3-(2-methylphenyl)cyclobutyl]amino]pentanoic acid
CID 122039850
2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid
CID 65054889
2-(2-phenylanilino)pentanoic acid
CID 83037413
(2S)-2-anilinopentanoic acid
CID 22847649
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid
CID 2756111
2-(benzhydrylamino)pentanoic acid
CID 65055273
2-(9H-xanthene-9-carbonylamino)pentanoic acid
CID 120534631
2-[(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)amino]pentanoic acid
CID 122039830
2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]pentanoic acid
CID 83069027
2-(9H-fluoren-9-ylamino)propan-1-ol
CID 43499687
2-(tritylamino)pentanoic acid
CID 70010724
2-[(1-hydroxy-1-phenylpropan-2-yl)amino]pentanoic acid
CID 82312104

Frequently Asked Questions

What is the IUPAC name of 2-(9H-fluoren-9-ylamino)pentanoic acid?
The IUPAC name of 2-(9H-fluoren-9-ylamino)pentanoic acid (CID 65054645) is 2-(9H-fluoren-9-ylamino)pentanoic acid.
What is the SMILES notation for 2-(9H-fluoren-9-ylamino)pentanoic acid?
The canonical SMILES for 2-(9H-fluoren-9-ylamino)pentanoic acid is CCCC(NC1c2ccccc2-c2ccccc21)C(=O)O.
What is the InChIKey of 2-(9H-fluoren-9-ylamino)pentanoic acid?
The InChIKey is MPOQNNPAVQIXLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO2/c1-2-7-16(18(20)21)19-17-14-10-5-3-8-12(14)13-9-4-6-11-15(13)17/h3-6,8-11,16-17,19H,2,7H2,1H3,(H,20,21).
What are the key properties of 2-(9H-fluoren-9-ylamino)pentanoic acid?
2-(9H-fluoren-9-ylamino)pentanoic acid has a molecular weight of 281.36 g/mol, XLogP of 3.60, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9H-fluoren-9-ylamino)pentanoic acid is sourced from PubChem (CID 65054645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).