2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid

C15H21NO2 — CID 65054889

IUPAC2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid
SMILESCCCC(NC1CCCc2ccccc21)C(=O)O
InChIInChI=1S/C15H21NO2/c1-2-6-14(15(17)18)16-13-10-5-8-11-7-3-4-9-12(11)13/h3-4,7,9,13-14,16H,2,5-6,8,10H2,1H3,(H,17,18)
InChIKeyFKXNFZOXKTUIGD-UHFFFAOYSA-N
MW247.34 g/mol
LogP2.91
Rot. Bonds5

About 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid

2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid (PubChem CID 65054889) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid.

Molecular Properties

Compound Name2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid
PubChem CID65054889
Molecular FormulaC15H21NO2
Molecular Weight247.34 g/mol
Exact Mass247.16
IUPAC Name2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid
SMILESCCCC(NC1CCCc2ccccc21)C(=O)O
InChIInChI=1S/C15H21NO2/c1-2-6-14(15(17)18)16-13-10-5-8-11-7-3-4-9-12(11)13/h3-4,7,9,13-14,16H,2,5-6,8,10H2,1H3,(H,17,18)
InChIKeyFKXNFZOXKTUIGD-UHFFFAOYSA-N
XLogP2.91
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.34
LogP ≤ 52.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid?
The IUPAC name of 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid (CID 65054889) is 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid.
What is the SMILES notation for 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid?
The canonical SMILES for 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid is CCCC(NC1CCCc2ccccc21)C(=O)O.
What is the InChIKey of 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid?
The InChIKey is FKXNFZOXKTUIGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-2-6-14(15(17)18)16-13-10-5-8-11-7-3-4-9-12(11)13/h3-4,7,9,13-14,16H,2,5-6,8,10H2,1H3,(H,17,18).
What are the key properties of 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid?
2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid has a molecular weight of 247.34 g/mol, XLogP of 2.91, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)pentanoic acid is sourced from PubChem (CID 65054889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).