C14H18FNO2 — CID 83069027
2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]pentanoic acid (PubChem CID 83069027) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]pentanoic acid.
| Compound Name | 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 83069027 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]pentanoic acid |
| SMILES | CCCC(NC1CCc2c(F)cccc21)C(=O)O |
| InChI | InChI=1S/C14H18FNO2/c1-2-4-13(14(17)18)16-12-8-7-9-10(12)5-3-6-11(9)15/h3,5-6,12-13,16H,2,4,7-8H2,1H3,(H,17,18) |
| InChIKey | ZHRNJTHNRIEBCG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |