C13H14F3NO2S — CID 65057479
2-[cyclopropyl-[[4-(trifluoromethylsulfanyl)phenyl]methyl]amino]acetic acid (PubChem CID 65057479) has the molecular formula C13H14F3NO2S and a molecular weight of 305.32 g/mol. Its IUPAC name is 2-[cyclopropyl-[[4-(trifluoromethylsulfanyl)phenyl]methyl]amino]acetic acid.
| Compound Name | 2-[cyclopropyl-[[4-(trifluoromethylsulfanyl)phenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 65057479 |
| Molecular Formula | C13H14F3NO2S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-[cyclopropyl-[[4-(trifluoromethylsulfanyl)phenyl]methyl]amino]acetic acid |
| SMILES | O=C(O)CN(Cc1ccc(SC(F)(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C13H14F3NO2S/c14-13(15,16)20-11-5-1-9(2-6-11)7-17(8-12(18)19)10-3-4-10/h1-2,5-6,10H,3-4,7-8H2,(H,18,19) |
| InChIKey | UQOLRISWAVAKBL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |