C16H23NO4 — CID 65067161
2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)-(2-methoxyethyl)amino]acetic acid (PubChem CID 65067161) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 65067161 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-[(7-hydroxy-3,4-dimethyl-2,3-dihydro-1H-inden-1-yl)-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C1CC(C)c2c(C)ccc(O)c21 |
| InChI | InChI=1S/C16H23NO4/c1-10-4-5-13(18)16-12(8-11(2)15(10)16)17(6-7-21-3)9-14(19)20/h4-5,11-12,18H,6-9H2,1-3H3,(H,19,20) |
| InChIKey | HECPCCUIEQFMOS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|