C13H24O3 — CID 65087693
methyl 2-(1-hydroxy-4,4-dimethylcycloheptyl)propanoate (PubChem CID 65087693) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is methyl 2-(1-hydroxy-4,4-dimethylcycloheptyl)propanoate.
| Compound Name | methyl 2-(1-hydroxy-4,4-dimethylcycloheptyl)propanoate |
|---|---|
| PubChem CID | 65087693 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | methyl 2-(1-hydroxy-4,4-dimethylcycloheptyl)propanoate |
| SMILES | COC(=O)C(C)C1(O)CCCC(C)(C)CC1 |
| InChI | InChI=1S/C13H24O3/c1-10(11(14)16-4)13(15)7-5-6-12(2,3)8-9-13/h10,15H,5-9H2,1-4H3 |
| InChIKey | IGXHFIRDRBQZIG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |