About N'-(3-ethylsulfonylpropyl)-N'-methyl-N-propan-2-ylethane-1,2-diamine
N'-(3-ethylsulfonylpropyl)-N'-methyl-N-propan-2-ylethane-1,2-diamine (PubChem CID 65093188) has the molecular formula C11H26N2O2S
and a molecular weight of 250.41 g/mol. Its IUPAC name is N'-(3-ethylsulfonylpropyl)-N'-methyl-N-propan-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(3-ethylsulfonylpropyl)-N'-methyl-N-propan-2-ylethane-1,2-diamine |
| PubChem CID | 65093188 |
| Molecular Formula | C11H26N2O2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | N'-(3-ethylsulfonylpropyl)-N'-methyl-N-propan-2-ylethane-1,2-diamine |
| SMILES | CCS(=O)(=O)CCCN(C)CCNC(C)C |
| InChI | InChI=1S/C11H26N2O2S/c1-5-16(14,15)10-6-8-13(4)9-7-12-11(2)3/h11-12H,5-10H2,1-4H3 |
| InChIKey | ZUXBTVRKQLNWTG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(3-ethylsulfonylpropyl)-N'-methyl-N-propan-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-ethylsulfonylpropyl)-N'-methyl-N-propan-2-ylethane-1,2-diamine?
The IUPAC name of N'-(3-ethylsulfonylpropyl)-N'-methyl-N-propan-2-ylethane-1,2-diamine (CID 65093188) is N'-(3-ethylsulfonylpropyl)-N'-methyl-N-propan-2-ylethane-1,2-diamine.
What is the SMILES notation for N'-(3-ethylsulfonylpropyl)-N'-methyl-N-propan-2-ylethane-1,2-diamine?
The canonical SMILES for N'-(3-ethylsulfonylpropyl)-N'-methyl-N-propan-2-ylethane-1,2-diamine is CCS(=O)(=O)CCCN(C)CCNC(C)C.
What is the InChIKey of N'-(3-ethylsulfonylpropyl)-N'-methyl-N-propan-2-ylethane-1,2-diamine?
The InChIKey is ZUXBTVRKQLNWTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N2O2S/c1-5-16(14,15)10-6-8-13(4)9-7-12-11(2)3/h11-12H,5-10H2,1-4H3.
What are the key properties of N'-(3-ethylsulfonylpropyl)-N'-methyl-N-propan-2-ylethane-1,2-diamine?
N'-(3-ethylsulfonylpropyl)-N'-methyl-N-propan-2-ylethane-1,2-diamine has a molecular weight of 250.41 g/mol, XLogP of 0.74, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-ethylsulfonylpropyl)-N'-methyl-N-propan-2-ylethane-1,2-diamine is sourced from PubChem (CID 65093188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).