C17H31NO2 — CID 65094686
1-(4-tert-butylcycloheptyl)-2-methylpyrrolidine-2-carboxylic acid (PubChem CID 65094686) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 1-(4-tert-butylcycloheptyl)-2-methylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-(4-tert-butylcycloheptyl)-2-methylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 65094686 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | 1-(4-tert-butylcycloheptyl)-2-methylpyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)C1CCCC(N2CCCC2(C)C(=O)O)CC1 |
| InChI | InChI=1S/C17H31NO2/c1-16(2,3)13-7-5-8-14(10-9-13)18-12-6-11-17(18,4)15(19)20/h13-14H,5-12H2,1-4H3,(H,19,20) |
| InChIKey | VTDRKQXFXQRKTM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |