C19H36N2 — CID 66209937
5-(4-tert-butylcycloheptyl)-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66209937) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is 5-(4-tert-butylcycloheptyl)-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(4-tert-butylcycloheptyl)-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66209937 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | 5-(4-tert-butylcycloheptyl)-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC(C)(C)C1CCCC(N2CC3CNCC3C2(C)C)CC1 |
| InChI | InChI=1S/C19H36N2/c1-18(2,3)15-7-6-8-16(10-9-15)21-13-14-11-20-12-17(14)19(21,4)5/h14-17,20H,6-13H2,1-5H3 |
| InChIKey | MXUWWTLLLPWAOO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |