C16H30N2O — CID 66209935
4,4-dimethyl-5-(2-propan-2-yloxan-4-yl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66209935) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 4,4-dimethyl-5-(2-propan-2-yloxan-4-yl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 4,4-dimethyl-5-(2-propan-2-yloxan-4-yl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66209935 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 4,4-dimethyl-5-(2-propan-2-yloxan-4-yl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC(C)C1CC(N2CC3CNCC3C2(C)C)CCO1 |
| InChI | InChI=1S/C16H30N2O/c1-11(2)15-7-13(5-6-19-15)18-10-12-8-17-9-14(12)16(18,3)4/h11-15,17H,5-10H2,1-4H3 |
| InChIKey | OEPDOSFVYSDITB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |