C14H12IN3O2 — CID 65098946
N-[2-[(5-iodo-2-pyridinyl)amino]-2-oxoethyl]benzamide (PubChem CID 65098946) has the molecular formula C14H12IN3O2 and a molecular weight of 381.17 g/mol. Its IUPAC name is N-[2-[(5-iodo-2-pyridinyl)amino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[(5-iodo-2-pyridinyl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 65098946 |
| Molecular Formula | C14H12IN3O2 |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | N-[2-[(5-iodo-2-pyridinyl)amino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)Nc1ccc(I)cn1 |
| InChI | InChI=1S/C14H12IN3O2/c15-11-6-7-12(16-8-11)18-13(19)9-17-14(20)10-4-2-1-3-5-10/h1-8H,9H2,(H,17,20)(H,16,18,19) |
| InChIKey | VGCZZDIFIVBXSE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|