C15H11Cl2F3 — CID 65100290
1-chloro-4-[chloro-(2,4,6-trifluorophenyl)methyl]-2,5-dimethylbenzene (PubChem CID 65100290) has the molecular formula C15H11Cl2F3 and a molecular weight of 319.15 g/mol. Its IUPAC name is 1-chloro-4-[chloro-(2,4,6-trifluorophenyl)methyl]-2,5-dimethylbenzene.
| Compound Name | 1-chloro-4-[chloro-(2,4,6-trifluorophenyl)methyl]-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 65100290 |
| Molecular Formula | C15H11Cl2F3 |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 1-chloro-4-[chloro-(2,4,6-trifluorophenyl)methyl]-2,5-dimethylbenzene |
| SMILES | Cc1cc(C(Cl)c2c(F)cc(F)cc2F)c(C)cc1Cl |
| InChI | InChI=1S/C15H11Cl2F3/c1-7-4-11(16)8(2)3-10(7)15(17)14-12(19)5-9(18)6-13(14)20/h3-6,15H,1-2H3 |
| InChIKey | NBABFOJXIIBHJK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|