C16H21NO — CID 65102288
spiro[3,4,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-2,1'-cyclopentane] (PubChem CID 65102288) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is spiro[3,4,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-2,1'-cyclopentane].
| Compound Name | spiro[3,4,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-2,1'-cyclopentane] |
|---|---|
| PubChem CID | 65102288 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | spiro[3,4,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine-2,1'-cyclopentane] |
| SMILES | c1ccc2c(c1)CCC1NCC3(CCCC3)OC21 |
| InChI | InChI=1S/C16H21NO/c1-2-6-13-12(5-1)7-8-14-15(13)18-16(11-17-14)9-3-4-10-16/h1-2,5-6,14-15,17H,3-4,7-11H2 |
| InChIKey | VJTXSSGIEHHTQE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |