C13H21N3O2 — CID 6510849
4-[(Z)-(dimethylhydrazinylidene)methyl]benzoic acid;propan-2-amine (PubChem CID 6510849) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-[(Z)-(dimethylhydrazinylidene)methyl]benzoic acid;propan-2-amine.
| Compound Name | 4-[(Z)-(dimethylhydrazinylidene)methyl]benzoic acid;propan-2-amine |
|---|---|
| PubChem CID | 6510849 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 4-[(Z)-(dimethylhydrazinylidene)methyl]benzoic acid;propan-2-amine |
| SMILES | CC(C)N.CN(C)/N=C\c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C10H12N2O2.C3H9N/c1-12(2)11-7-8-3-5-9(6-4-8)10(13)14;1-3(2)4/h3-7H,1-2H3,(H,13,14);3H,4H2,1-2H3/b11-7-; |
| InChIKey | DXELGEZMMXLOJZ-AJULUCINSA-N |
| XLogP | 1.63 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|